C28H28FN3O5 — CID 171683900
2-(2,5-dimethylphenoxy)-N-[4-[1-(3-fluoro-5-nitrobenzoyl)piperidin-4-yl]phenyl]acetamide (PubChem CID 171683900) has the molecular formula C28H28FN3O5 and a molecular weight of 505.55 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-N-[4-[1-(3-fluoro-5-nitrobenzoyl)piperidin-4-yl]phenyl]acetamide.
| Compound Name | 2-(2,5-dimethylphenoxy)-N-[4-[1-(3-fluoro-5-nitrobenzoyl)piperidin-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 171683900 |
| Molecular Formula | C28H28FN3O5 |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-N-[4-[1-(3-fluoro-5-nitrobenzoyl)piperidin-4-yl]phenyl]acetamide |
| SMILES | Cc1ccc(C)c(OCC(=O)Nc2ccc(C3CCN(C(=O)c4cc(F)cc([N+](=O)[O-])c4)CC3)cc2)c1 |
| InChI | InChI=1S/C28H28FN3O5/c1-18-3-4-19(2)26(13-18)37-17-27(33)30-24-7-5-20(6-8-24)21-9-11-31(12-10-21)28(34)22-14-23(29)16-25(15-22)32(35)36/h3-8,13-16,21H,9-12,17H2,1-2H3,(H,30,33) |
| InChIKey | UYHYBPZVSLJBOB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|