C27H24ClF2N3O5 — CID 171685417
2-(6-chloro-2-fluoro-3-methoxyphenyl)-N-[4-[1-(2-fluoro-4-nitrobenzoyl)piperidin-4-yl]phenyl]acetamide (PubChem CID 171685417) has the molecular formula C27H24ClF2N3O5 and a molecular weight of 543.95 g/mol. Its IUPAC name is 2-(6-chloro-2-fluoro-3-methoxyphenyl)-N-[4-[1-(2-fluoro-4-nitrobenzoyl)piperidin-4-yl]phenyl]acetamide.
| Compound Name | 2-(6-chloro-2-fluoro-3-methoxyphenyl)-N-[4-[1-(2-fluoro-4-nitrobenzoyl)piperidin-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 171685417 |
| Molecular Formula | C27H24ClF2N3O5 |
| Molecular Weight | 543.95 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | 2-(6-chloro-2-fluoro-3-methoxyphenyl)-N-[4-[1-(2-fluoro-4-nitrobenzoyl)piperidin-4-yl]phenyl]acetamide |
| SMILES | COc1ccc(Cl)c(CC(=O)Nc2ccc(C3CCN(C(=O)c4ccc([N+](=O)[O-])cc4F)CC3)cc2)c1F |
| InChI | InChI=1S/C27H24ClF2N3O5/c1-38-24-9-8-22(28)21(26(24)30)15-25(34)31-18-4-2-16(3-5-18)17-10-12-32(13-11-17)27(35)20-7-6-19(33(36)37)14-23(20)29/h2-9,14,17H,10-13,15H2,1H3,(H,31,34) |
| InChIKey | MRVQLHMTJHHGLM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.95 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|