C26H27Cl2FN4O2 — CID 171683468
N-[4-[1-(4,5-dichloro-2-fluorobenzoyl)piperidin-4-yl]phenyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 171683468) has the molecular formula C26H27Cl2FN4O2 and a molecular weight of 517.43 g/mol. Its IUPAC name is N-[4-[1-(4,5-dichloro-2-fluorobenzoyl)piperidin-4-yl]phenyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | N-[4-[1-(4,5-dichloro-2-fluorobenzoyl)piperidin-4-yl]phenyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 171683468 |
| Molecular Formula | C26H27Cl2FN4O2 |
| Molecular Weight | 517.43 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | N-[4-[1-(4,5-dichloro-2-fluorobenzoyl)piperidin-4-yl]phenyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | Cc1nn(C)c(C)c1CC(=O)Nc1ccc(C2CCN(C(=O)c3cc(Cl)c(Cl)cc3F)CC2)cc1 |
| InChI | InChI=1S/C26H27Cl2FN4O2/c1-15-20(16(2)32(3)31-15)13-25(34)30-19-6-4-17(5-7-19)18-8-10-33(11-9-18)26(35)21-12-22(27)23(28)14-24(21)29/h4-7,12,14,18H,8-11,13H2,1-3H3,(H,30,34) |
| InChIKey | JKHKWRAMILHGJJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.43 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|