C27H26FN3O6 — CID 171684890
N-[4-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]phenyl]-3-fluoro-2-nitrobenzamide (PubChem CID 171684890) has the molecular formula C27H26FN3O6 and a molecular weight of 507.52 g/mol. Its IUPAC name is N-[4-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]phenyl]-3-fluoro-2-nitrobenzamide.
| Compound Name | N-[4-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]phenyl]-3-fluoro-2-nitrobenzamide |
|---|---|
| PubChem CID | 171684890 |
| Molecular Formula | C27H26FN3O6 |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | N-[4-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]phenyl]-3-fluoro-2-nitrobenzamide |
| SMILES | COc1cccc(OC)c1C(=O)N1CCC(c2ccc(NC(=O)c3cccc(F)c3[N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C27H26FN3O6/c1-36-22-7-4-8-23(37-2)24(22)27(33)30-15-13-18(14-16-30)17-9-11-19(12-10-17)29-26(32)20-5-3-6-21(28)25(20)31(34)35/h3-12,18H,13-16H2,1-2H3,(H,29,32) |
| InChIKey | PIXHAWDTISOAJK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|