C28H24F2N4O5 — CID 171698938
N-[4-[1-(5,6-difluoro-1H-indole-2-carbonyl)piperidin-4-yl]phenyl]-3-methoxy-4-nitrobenzamide (PubChem CID 171698938) has the molecular formula C28H24F2N4O5 and a molecular weight of 534.52 g/mol. Its IUPAC name is N-[4-[1-(5,6-difluoro-1H-indole-2-carbonyl)piperidin-4-yl]phenyl]-3-methoxy-4-nitrobenzamide.
| Compound Name | N-[4-[1-(5,6-difluoro-1H-indole-2-carbonyl)piperidin-4-yl]phenyl]-3-methoxy-4-nitrobenzamide |
|---|---|
| PubChem CID | 171698938 |
| Molecular Formula | C28H24F2N4O5 |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | N-[4-[1-(5,6-difluoro-1H-indole-2-carbonyl)piperidin-4-yl]phenyl]-3-methoxy-4-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(C3CCN(C(=O)c4cc5cc(F)c(F)cc5[nH]4)CC3)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H24F2N4O5/c1-39-26-14-18(4-7-25(26)34(37)38)27(35)31-20-5-2-16(3-6-20)17-8-10-33(11-9-17)28(36)24-13-19-12-21(29)22(30)15-23(19)32-24/h2-7,12-15,17,32H,8-11H2,1H3,(H,31,35) |
| InChIKey | VEHQUBUYYNRGND-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 117.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|