C28H28ClN3O5 — CID 171681760
2-(4-chlorophenyl)-N-[4-[1-(3-methoxy-4-nitrobenzoyl)piperidin-4-yl]phenyl]propanamide (PubChem CID 171681760) has the molecular formula C28H28ClN3O5 and a molecular weight of 522.00 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[4-[1-(3-methoxy-4-nitrobenzoyl)piperidin-4-yl]phenyl]propanamide.
| Compound Name | 2-(4-chlorophenyl)-N-[4-[1-(3-methoxy-4-nitrobenzoyl)piperidin-4-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 171681760 |
| Molecular Formula | C28H28ClN3O5 |
| Molecular Weight | 522.00 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[4-[1-(3-methoxy-4-nitrobenzoyl)piperidin-4-yl]phenyl]propanamide |
| SMILES | COc1cc(C(=O)N2CCC(c3ccc(NC(=O)C(C)c4ccc(Cl)cc4)cc3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H28ClN3O5/c1-18(19-3-8-23(29)9-4-19)27(33)30-24-10-5-20(6-11-24)21-13-15-31(16-14-21)28(34)22-7-12-25(32(35)36)26(17-22)37-2/h3-12,17-18,21H,13-16H2,1-2H3,(H,30,33) |
| InChIKey | PSXCHYGYZIOXMH-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.00 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|