C28H26FN3O6 — CID 171678343
ethyl 4-[4-[4-[(3-fluoro-2-nitrobenzoyl)amino]phenyl]piperidine-1-carbonyl]benzoate (PubChem CID 171678343) has the molecular formula C28H26FN3O6 and a molecular weight of 519.53 g/mol. Its IUPAC name is ethyl 4-[4-[4-[(3-fluoro-2-nitrobenzoyl)amino]phenyl]piperidine-1-carbonyl]benzoate.
| Compound Name | ethyl 4-[4-[4-[(3-fluoro-2-nitrobenzoyl)amino]phenyl]piperidine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 171678343 |
| Molecular Formula | C28H26FN3O6 |
| Molecular Weight | 519.53 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | ethyl 4-[4-[4-[(3-fluoro-2-nitrobenzoyl)amino]phenyl]piperidine-1-carbonyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C(=O)N2CCC(c3ccc(NC(=O)c4cccc(F)c4[N+](=O)[O-])cc3)CC2)cc1 |
| InChI | InChI=1S/C28H26FN3O6/c1-2-38-28(35)21-8-6-20(7-9-21)27(34)31-16-14-19(15-17-31)18-10-12-22(13-11-18)30-26(33)23-4-3-5-24(29)25(23)32(36)37/h3-13,19H,2,14-17H2,1H3,(H,30,33) |
| InChIKey | DPABXNMAAIAJSA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|