C27H24FN5O4 — CID 171681237
N-[4-[1-(6-fluoro-2-methyl-3-nitrobenzoyl)piperidin-4-yl]phenyl]-1H-pyrrolo[3,2-c]pyridine-4-carboxamide (PubChem CID 171681237) has the molecular formula C27H24FN5O4 and a molecular weight of 501.52 g/mol. Its IUPAC name is N-[4-[1-(6-fluoro-2-methyl-3-nitrobenzoyl)piperidin-4-yl]phenyl]-1H-pyrrolo[3,2-c]pyridine-4-carboxamide.
| Compound Name | N-[4-[1-(6-fluoro-2-methyl-3-nitrobenzoyl)piperidin-4-yl]phenyl]-1H-pyrrolo[3,2-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 171681237 |
| Molecular Formula | C27H24FN5O4 |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | N-[4-[1-(6-fluoro-2-methyl-3-nitrobenzoyl)piperidin-4-yl]phenyl]-1H-pyrrolo[3,2-c]pyridine-4-carboxamide |
| SMILES | Cc1c([N+](=O)[O-])ccc(F)c1C(=O)N1CCC(c2ccc(NC(=O)c3nccc4[nH]ccc34)cc2)CC1 |
| InChI | InChI=1S/C27H24FN5O4/c1-16-23(33(36)37)7-6-21(28)24(16)27(35)32-14-10-18(11-15-32)17-2-4-19(5-3-17)31-26(34)25-20-8-12-29-22(20)9-13-30-25/h2-9,12-13,18,29H,10-11,14-15H2,1H3,(H,31,34) |
| InChIKey | QRCOGVASYOFEMI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 121.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|