C28H29FN4O5 — CID 171685130
N-[4-[1-[3-(2-fluoro-4-methoxyphenyl)propanoyl]piperidin-4-yl]phenyl]-4-methyl-5-nitropyridine-2-carboxamide (PubChem CID 171685130) has the molecular formula C28H29FN4O5 and a molecular weight of 520.56 g/mol. Its IUPAC name is N-[4-[1-[3-(2-fluoro-4-methoxyphenyl)propanoyl]piperidin-4-yl]phenyl]-4-methyl-5-nitropyridine-2-carboxamide.
| Compound Name | N-[4-[1-[3-(2-fluoro-4-methoxyphenyl)propanoyl]piperidin-4-yl]phenyl]-4-methyl-5-nitropyridine-2-carboxamide |
|---|---|
| PubChem CID | 171685130 |
| Molecular Formula | C28H29FN4O5 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | N-[4-[1-[3-(2-fluoro-4-methoxyphenyl)propanoyl]piperidin-4-yl]phenyl]-4-methyl-5-nitropyridine-2-carboxamide |
| SMILES | COc1ccc(CCC(=O)N2CCC(c3ccc(NC(=O)c4cc(C)c([N+](=O)[O-])cn4)cc3)CC2)c(F)c1 |
| InChI | InChI=1S/C28H29FN4O5/c1-18-15-25(30-17-26(18)33(36)37)28(35)31-22-7-3-19(4-8-22)20-11-13-32(14-12-20)27(34)10-6-21-5-9-23(38-2)16-24(21)29/h3-5,7-9,15-17,20H,6,10-14H2,1-2H3,(H,31,35) |
| InChIKey | NDNGAWVASCHJEZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|