C30H26N4O5 — CID 171681134
N-[4-[1-(3-hydroxy-5-nitrobenzoyl)piperidin-4-yl]phenyl]-2-phenylpyridine-3-carboxamide (PubChem CID 171681134) has the molecular formula C30H26N4O5 and a molecular weight of 522.56 g/mol. Its IUPAC name is N-[4-[1-(3-hydroxy-5-nitrobenzoyl)piperidin-4-yl]phenyl]-2-phenylpyridine-3-carboxamide.
| Compound Name | N-[4-[1-(3-hydroxy-5-nitrobenzoyl)piperidin-4-yl]phenyl]-2-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 171681134 |
| Molecular Formula | C30H26N4O5 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | N-[4-[1-(3-hydroxy-5-nitrobenzoyl)piperidin-4-yl]phenyl]-2-phenylpyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C2CCN(C(=O)c3cc(O)cc([N+](=O)[O-])c3)CC2)cc1)c1cccnc1-c1ccccc1 |
| InChI | InChI=1S/C30H26N4O5/c35-26-18-23(17-25(19-26)34(38)39)30(37)33-15-12-21(13-16-33)20-8-10-24(11-9-20)32-29(36)27-7-4-14-31-28(27)22-5-2-1-3-6-22/h1-11,14,17-19,21,35H,12-13,15-16H2,(H,32,36) |
| InChIKey | ZSLZFVWMVYMDJM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 125.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|