C17H18N2O2 — CID 63859040
(5-hydroxy-3-pyridinyl)-(4-phenylpiperidin-1-yl)methanone (PubChem CID 63859040) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is (5-hydroxy-3-pyridinyl)-(4-phenylpiperidin-1-yl)methanone.
| Compound Name | (5-hydroxy-3-pyridinyl)-(4-phenylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 63859040 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (5-hydroxy-3-pyridinyl)-(4-phenylpiperidin-1-yl)methanone |
| SMILES | O=C(c1cncc(O)c1)N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H18N2O2/c20-16-10-15(11-18-12-16)17(21)19-8-6-14(7-9-19)13-4-2-1-3-5-13/h1-5,10-12,14,20H,6-9H2 |
| InChIKey | AOBKHWQGLQVZBD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |