C19H15F3N2O7S — CID 86639640
ethyl 2-oxo-1-phenylmethoxy-4-(trifluoromethylsulfonyloxy)-1,8-naphthyridine-3-carboxylate (PubChem CID 86639640) has the molecular formula C19H15F3N2O7S and a molecular weight of 472.40 g/mol. Its IUPAC name is ethyl 2-oxo-1-phenylmethoxy-4-(trifluoromethylsulfonyloxy)-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 2-oxo-1-phenylmethoxy-4-(trifluoromethylsulfonyloxy)-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 86639640 |
| Molecular Formula | C19H15F3N2O7S |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | ethyl 2-oxo-1-phenylmethoxy-4-(trifluoromethylsulfonyloxy)-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(OS(=O)(=O)C(F)(F)F)c2cccnc2n(OCc2ccccc2)c1=O |
| InChI | InChI=1S/C19H15F3N2O7S/c1-2-29-18(26)14-15(31-32(27,28)19(20,21)22)13-9-6-10-23-16(13)24(17(14)25)30-11-12-7-4-3-5-8-12/h3-10H,2,11H2,1H3 |
| InChIKey | CQIDOGLOBPCVAQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 113.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|