C15H20N2O3 — CID 143284338
3,5-dimethyl-1-phenylmethoxypyrazole-4-carboxylic acid;ethane (PubChem CID 143284338) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3,5-dimethyl-1-phenylmethoxypyrazole-4-carboxylic acid;ethane.
| Compound Name | 3,5-dimethyl-1-phenylmethoxypyrazole-4-carboxylic acid;ethane |
|---|---|
| PubChem CID | 143284338 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 3,5-dimethyl-1-phenylmethoxypyrazole-4-carboxylic acid;ethane |
| SMILES | CC.Cc1nn(OCc2ccccc2)c(C)c1C(=O)O |
| InChI | InChI=1S/C13H14N2O3.C2H6/c1-9-12(13(16)17)10(2)15(14-9)18-8-11-6-4-3-5-7-11;1-2/h3-7H,8H2,1-2H3,(H,16,17);1-2H3 |
| InChIKey | DGFZQQLCJJVKRN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |