C21H31N3O3 — CID 168886594
ethane;ethyl 4-(5-methyl-1-phenylmethoxypyrazol-4-yl)piperidine-1-carboxylate (PubChem CID 168886594) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is ethane;ethyl 4-(5-methyl-1-phenylmethoxypyrazol-4-yl)piperidine-1-carboxylate.
| Compound Name | ethane;ethyl 4-(5-methyl-1-phenylmethoxypyrazol-4-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168886594 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | ethane;ethyl 4-(5-methyl-1-phenylmethoxypyrazol-4-yl)piperidine-1-carboxylate |
| SMILES | CC.CCOC(=O)N1CCC(c2cnn(OCc3ccccc3)c2C)CC1 |
| InChI | InChI=1S/C19H25N3O3.C2H6/c1-3-24-19(23)21-11-9-17(10-12-21)18-13-20-22(15(18)2)25-14-16-7-5-4-6-8-16;1-2/h4-8,13,17H,3,9-12,14H2,1-2H3;1-2H3 |
| InChIKey | WMQMDBOPPGWHJI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |