C26H27N5O4 — CID 123646672
ethyl 4-methyl-7-oxo-8-phenylmethoxy-5-(3-pyridin-3-ylpropylamino)pyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 123646672) has the molecular formula C26H27N5O4 and a molecular weight of 473.53 g/mol. Its IUPAC name is ethyl 4-methyl-7-oxo-8-phenylmethoxy-5-(3-pyridin-3-ylpropylamino)pyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 4-methyl-7-oxo-8-phenylmethoxy-5-(3-pyridin-3-ylpropylamino)pyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 123646672 |
| Molecular Formula | C26H27N5O4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | ethyl 4-methyl-7-oxo-8-phenylmethoxy-5-(3-pyridin-3-ylpropylamino)pyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1c(NCCCc2cccnc2)c2c(C)ncnc2n(OCc2ccccc2)c1=O |
| InChI | InChI=1S/C26H27N5O4/c1-3-34-26(33)22-23(28-14-8-12-19-11-7-13-27-15-19)21-18(2)29-17-30-24(21)31(25(22)32)35-16-20-9-5-4-6-10-20/h4-7,9-11,13,15,17,28H,3,8,12,14,16H2,1-2H3 |
| InChIKey | JIEKYGBWDHWDIS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|