C14H13F3N2O7S — CID 87626954
ethyl (1S,8R)-11-hydroxy-10-oxo-4-(trifluoromethylsulfonyloxy)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylate (PubChem CID 87626954) has the molecular formula C14H13F3N2O7S and a molecular weight of 410.33 g/mol. Its IUPAC name is ethyl (1S,8R)-11-hydroxy-10-oxo-4-(trifluoromethylsulfonyloxy)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylate.
| Compound Name | ethyl (1S,8R)-11-hydroxy-10-oxo-4-(trifluoromethylsulfonyloxy)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylate |
|---|---|
| PubChem CID | 87626954 |
| Molecular Formula | C14H13F3N2O7S |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | ethyl (1S,8R)-11-hydroxy-10-oxo-4-(trifluoromethylsulfonyloxy)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylate |
| SMILES | CCOC(=O)[C@H]1c2ccc(OS(=O)(=O)C(F)(F)F)cc2[C@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C14H13F3N2O7S/c1-2-25-12(20)11-8-4-3-7(26-27(23,24)14(15,16)17)5-9(8)10-6-18(11)13(21)19(10)22/h3-5,10-11,22H,2,6H2,1H3/t10-,11-/m1/s1 |
| InChIKey | XQUZLQQTIYXOGF-GHMZBOCLSA-N |
| XLogP | 1.70 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|