C12H12N2O4 — CID 69345804
methyl (1R)-11-hydroxy-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxylate (PubChem CID 69345804) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is methyl (1R)-11-hydroxy-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxylate.
| Compound Name | methyl (1R)-11-hydroxy-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxylate |
|---|---|
| PubChem CID | 69345804 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | methyl (1R)-11-hydroxy-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxylate |
| SMILES | COC(=O)C1c2ccccc2[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C12H12N2O4/c1-18-11(15)10-8-5-3-2-4-7(8)9-6-13(10)12(16)14(9)17/h2-5,9-10,17H,6H2,1H3/t9-,10?/m0/s1 |
| InChIKey | SBDWIMAPMNCCFQ-RGURZIINSA-N |
| XLogP | 1.08 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|