C11H14BNO3 — CID 140807943
(1-methoxycarbonyl-1,3-dihydroisoindol-2-yl)-methylborinic acid (PubChem CID 140807943) has the molecular formula C11H14BNO3 and a molecular weight of 219.05 g/mol. Its IUPAC name is (1-methoxycarbonyl-1,3-dihydroisoindol-2-yl)-methylborinic acid.
| Compound Name | (1-methoxycarbonyl-1,3-dihydroisoindol-2-yl)-methylborinic acid |
|---|---|
| PubChem CID | 140807943 |
| Molecular Formula | C11H14BNO3 |
| Molecular Weight | 219.05 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | (1-methoxycarbonyl-1,3-dihydroisoindol-2-yl)-methylborinic acid |
| SMILES | COC(=O)C1c2ccccc2CN1B(C)O |
| InChI | InChI=1S/C11H14BNO3/c1-12(15)13-7-8-5-3-4-6-9(8)10(13)11(14)16-2/h3-6,10,15H,7H2,1-2H3 |
| InChIKey | AJMOLYIJVWFCAE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.05 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|