C15H22NO3P — CID 67806132
methyl 2-diethylphosphoryl-3,4-dihydro-1H-isoquinoline-1-carboxylate (PubChem CID 67806132) has the molecular formula C15H22NO3P and a molecular weight of 295.32 g/mol. Its IUPAC name is methyl 2-diethylphosphoryl-3,4-dihydro-1H-isoquinoline-1-carboxylate.
| Compound Name | methyl 2-diethylphosphoryl-3,4-dihydro-1H-isoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 67806132 |
| Molecular Formula | C15H22NO3P |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | methyl 2-diethylphosphoryl-3,4-dihydro-1H-isoquinoline-1-carboxylate |
| SMILES | CCP(=O)(CC)N1CCc2ccccc2C1C(=O)OC |
| InChI | InChI=1S/C15H22NO3P/c1-4-20(18,5-2)16-11-10-12-8-6-7-9-13(12)14(16)15(17)19-3/h6-9,14H,4-5,10-11H2,1-3H3 |
| InChIKey | XFDFTUKVULDYJM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|