C16H21N3O7 — CID 87626671
11-hydroxy-N-methoxy-4-(2-methoxyethoxymethoxy)-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 87626671) has the molecular formula C16H21N3O7 and a molecular weight of 367.36 g/mol. Its IUPAC name is 11-hydroxy-N-methoxy-4-(2-methoxyethoxymethoxy)-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | 11-hydroxy-N-methoxy-4-(2-methoxyethoxymethoxy)-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 87626671 |
| Molecular Formula | C16H21N3O7 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 11-hydroxy-N-methoxy-4-(2-methoxyethoxymethoxy)-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | COCCOCOc1ccc2c(c1)C1CN(C(=O)N1O)C2C(=O)NOC |
| InChI | InChI=1S/C16H21N3O7/c1-23-5-6-25-9-26-10-3-4-11-12(7-10)13-8-18(16(21)19(13)22)14(11)15(20)17-24-2/h3-4,7,13-14,22H,5-6,8-9H2,1-2H3,(H,17,20) |
| InChIKey | HMUWDKPKSXGTGU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|