C24H28N2O7 — CID 68933505
ethyl (1S,8R)-4-(2-methoxyethoxymethoxy)-10-oxo-11-phenylmethoxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylate (PubChem CID 68933505) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is ethyl (1S,8R)-4-(2-methoxyethoxymethoxy)-10-oxo-11-phenylmethoxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylate.
| Compound Name | ethyl (1S,8R)-4-(2-methoxyethoxymethoxy)-10-oxo-11-phenylmethoxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylate |
|---|---|
| PubChem CID | 68933505 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | ethyl (1S,8R)-4-(2-methoxyethoxymethoxy)-10-oxo-11-phenylmethoxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylate |
| SMILES | CCOC(=O)[C@H]1c2ccc(OCOCCOC)cc2[C@H]2CN1C(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C24H28N2O7/c1-3-31-23(27)22-19-10-9-18(32-16-30-12-11-29-2)13-20(19)21-14-25(22)24(28)26(21)33-15-17-7-5-4-6-8-17/h4-10,13,21-22H,3,11-12,14-16H2,1-2H3/t21-,22-/m1/s1 |
| InChIKey | SPNGJKXSAZXPQW-FGZHOGPDSA-N |
| XLogP | 3.21 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|