C19H15F3N2O7S — CID 87715162
(1S,8R)-10-oxo-11-phenylmethoxy-4-(trifluoromethylsulfonyloxy)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylic acid (PubChem CID 87715162) has the molecular formula C19H15F3N2O7S and a molecular weight of 472.40 g/mol. Its IUPAC name is (1S,8R)-10-oxo-11-phenylmethoxy-4-(trifluoromethylsulfonyloxy)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylic acid.
| Compound Name | (1S,8R)-10-oxo-11-phenylmethoxy-4-(trifluoromethylsulfonyloxy)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylic acid |
|---|---|
| PubChem CID | 87715162 |
| Molecular Formula | C19H15F3N2O7S |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | (1S,8R)-10-oxo-11-phenylmethoxy-4-(trifluoromethylsulfonyloxy)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylic acid |
| SMILES | O=C(O)[C@H]1c2ccc(OS(=O)(=O)C(F)(F)F)cc2[C@H]2CN1C(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C19H15F3N2O7S/c20-19(21,22)32(28,29)31-12-6-7-13-14(8-12)15-9-23(16(13)17(25)26)18(27)24(15)30-10-11-4-2-1-3-5-11/h1-8,15-16H,9-10H2,(H,25,26)/t15-,16-/m1/s1 |
| InChIKey | UZFSKDJXRALTIX-HZPDHXFCSA-N |
| XLogP | 2.96 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|