C17H18N4O6 — CID 135376318
(1R,7S)-5-(2,2-dihydroxyethyl)-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxylic acid (PubChem CID 135376318) has the molecular formula C17H18N4O6 and a molecular weight of 374.35 g/mol. Its IUPAC name is (1R,7S)-5-(2,2-dihydroxyethyl)-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxylic acid.
| Compound Name | (1R,7S)-5-(2,2-dihydroxyethyl)-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxylic acid |
|---|---|
| PubChem CID | 135376318 |
| Molecular Formula | C17H18N4O6 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | (1R,7S)-5-(2,2-dihydroxyethyl)-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboxylic acid |
| SMILES | O=C(O)[C@@H]1c2c(cnn2CC(O)O)[C@@H]2CN1C(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C17H18N4O6/c22-13(23)8-20-14-11(6-18-20)12-7-19(15(14)16(24)25)17(26)21(12)27-9-10-4-2-1-3-5-10/h1-6,12-13,15,22-23H,7-9H2,(H,24,25)/t12-,15-/m0/s1 |
| InChIKey | MGOMBCCSIJBXMA-WFASDCNBSA-N |
| XLogP | 0.24 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|