C19H23N7O4 — CID 135376681
2-[[N-methyl-C-[(1R,7S)-5-methyl-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]carbonimidoyl]amino]oxyacetamide (PubChem CID 135376681) has the molecular formula C19H23N7O4 and a molecular weight of 413.44 g/mol. Its IUPAC name is 2-[[N-methyl-C-[(1R,7S)-5-methyl-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]carbonimidoyl]amino]oxyacetamide.
| Compound Name | 2-[[N-methyl-C-[(1R,7S)-5-methyl-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]carbonimidoyl]amino]oxyacetamide |
|---|---|
| PubChem CID | 135376681 |
| Molecular Formula | C19H23N7O4 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 2-[[N-methyl-C-[(1R,7S)-5-methyl-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]carbonimidoyl]amino]oxyacetamide |
| SMILES | C/N=C(\NOCC(N)=O)[C@@H]1c2c(cnn2C)[C@@H]2CN1C(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C19H23N7O4/c1-21-18(23-29-11-15(20)27)17-16-13(8-22-24(16)2)14-9-25(17)19(28)26(14)30-10-12-6-4-3-5-7-12/h3-8,14,17H,9-11H2,1-2H3,(H2,20,27)(H,21,23)/t14-,17-/m0/s1 |
| InChIKey | WIUKEUCTGKKKHH-YOEHRIQHSA-N |
| XLogP | 0.42 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|