C18H18N6O4 — CID 135376530
4-methyl-3-[(1R,7S)-5-methyl-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-1,2,4-oxadiazol-5-one (PubChem CID 135376530) has the molecular formula C18H18N6O4 and a molecular weight of 382.38 g/mol. Its IUPAC name is 4-methyl-3-[(1R,7S)-5-methyl-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-1,2,4-oxadiazol-5-one.
| Compound Name | 4-methyl-3-[(1R,7S)-5-methyl-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 135376530 |
| Molecular Formula | C18H18N6O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 4-methyl-3-[(1R,7S)-5-methyl-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-1,2,4-oxadiazol-5-one |
| SMILES | Cn1ncc2c1[C@@H](c1noc(=O)n1C)N1C[C@@H]2N(OCc2ccccc2)C1=O |
| InChI | InChI=1S/C18H18N6O4/c1-21-16(20-28-18(21)26)15-14-12(8-19-22(14)2)13-9-23(15)17(25)24(13)27-10-11-6-4-3-5-7-11/h3-8,13,15H,9-10H2,1-2H3/t13-,15-/m0/s1 |
| InChIKey | BXAPQGLJWSPVFE-ZFWWWQNUSA-N |
| XLogP | 1.12 |
| TPSA | 98.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |