C26H36N8O6 — CID 146626038
tert-butyl N-[2-[[2-[[N-methyl-C-[(1R,7S)-5-methyl-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]carbonimidoyl]amino]oxyacetyl]amino]ethyl]carbamate (PubChem CID 146626038) has the molecular formula C26H36N8O6 and a molecular weight of 556.62 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[[N-methyl-C-[(1R,7S)-5-methyl-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]carbonimidoyl]amino]oxyacetyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-[[N-methyl-C-[(1R,7S)-5-methyl-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]carbonimidoyl]amino]oxyacetyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 146626038 |
| Molecular Formula | C26H36N8O6 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | tert-butyl N-[2-[[2-[[N-methyl-C-[(1R,7S)-5-methyl-9-oxo-10-phenylmethoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]carbonimidoyl]amino]oxyacetyl]amino]ethyl]carbamate |
| SMILES | C/N=C(\NOCC(=O)NCCNC(=O)OC(C)(C)C)[C@@H]1c2c(cnn2C)[C@@H]2CN1C(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C26H36N8O6/c1-26(2,3)40-24(36)29-12-11-28-20(35)16-38-31-23(27-4)22-21-18(13-30-32(21)5)19-14-33(22)25(37)34(19)39-15-17-9-7-6-8-10-17/h6-10,13,19,22H,11-12,14-16H2,1-5H3,(H,27,31)(H,28,35)(H,29,36)/t19-,22-/m0/s1 |
| InChIKey | MKULHOCTQAEOBX-UGKGYDQZSA-N |
| XLogP | 1.58 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|