C12H19N7O8S — CID 154629268
[(1R,7S)-7-[N-(2-amino-2-oxoethoxy)-N'-methylcarbamimidoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate;hydrate (PubChem CID 154629268) has the molecular formula C12H19N7O8S and a molecular weight of 421.39 g/mol. Its IUPAC name is [(1R,7S)-7-[N-(2-amino-2-oxoethoxy)-N'-methylcarbamimidoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate;hydrate.
| Compound Name | [(1R,7S)-7-[N-(2-amino-2-oxoethoxy)-N'-methylcarbamimidoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate;hydrate |
|---|---|
| PubChem CID | 154629268 |
| Molecular Formula | C12H19N7O8S |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | [(1R,7S)-7-[N-(2-amino-2-oxoethoxy)-N'-methylcarbamimidoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate;hydrate |
| SMILES | C/N=C(\NOCC(N)=O)[C@@H]1c2c(cnn2C)[C@@H]2CN1C(=O)N2OS(=O)(=O)O.O |
| InChI | InChI=1S/C12H17N7O7S.H2O/c1-14-11(16-25-5-8(13)20)10-9-6(3-15-17(9)2)7-4-18(10)12(21)19(7)26-27(22,23)24;/h3,7,10H,4-5H2,1-2H3,(H2,13,20)(H,14,16)(H,22,23,24);1H2/t7-,10-;/m0./s1 |
| InChIKey | BPRXNZQWOIPCOD-YUWZRIFDSA-N |
| XLogP | -2.80 |
| TPSA | 213.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|