C13H17N7O7S — CID 90422623
[(1R,7S)-7-[(azetidine-3-carbonylamino)carbamoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate (PubChem CID 90422623) has the molecular formula C13H17N7O7S and a molecular weight of 415.39 g/mol. Its IUPAC name is [(1R,7S)-7-[(azetidine-3-carbonylamino)carbamoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate.
| Compound Name | [(1R,7S)-7-[(azetidine-3-carbonylamino)carbamoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90422623 |
| Molecular Formula | C13H17N7O7S |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | [(1R,7S)-7-[(azetidine-3-carbonylamino)carbamoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
| SMILES | Cn1ncc2c1[C@@H](C(=O)NNC(=O)C1CNC1)N1C[C@@H]2N(OS(=O)(=O)O)C1=O |
| InChI | InChI=1S/C13H17N7O7S/c1-18-9-7(4-15-18)8-5-19(13(23)20(8)27-28(24,25)26)10(9)12(22)17-16-11(21)6-2-14-3-6/h4,6,8,10,14H,2-3,5H2,1H3,(H,16,21)(H,17,22)(H,24,25,26)/t8-,10-/m0/s1 |
| InChIKey | QCRAKIALAAODLY-WPRPVWTQSA-N |
| XLogP | -2.65 |
| TPSA | 175.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|