C12H16N6O7S — CID 123419434
[7-(azetidin-3-yloxycarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate (PubChem CID 123419434) has the molecular formula C12H16N6O7S and a molecular weight of 388.36 g/mol. Its IUPAC name is [7-(azetidin-3-yloxycarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate.
| Compound Name | [7-(azetidin-3-yloxycarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 123419434 |
| Molecular Formula | C12H16N6O7S |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | [7-(azetidin-3-yloxycarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
| SMILES | Cn1ncc2c1C(C(=O)NOC1CNC1)N1CC2N(OS(=O)(=O)O)C1=O |
| InChI | InChI=1S/C12H16N6O7S/c1-16-9-7(4-14-16)8-5-17(12(20)18(8)25-26(21,22)23)10(9)11(19)15-24-6-2-13-3-6/h4,6,8,10,13H,2-3,5H2,1H3,(H,15,19)(H,21,22,23) |
| InChIKey | LRILFYMFWMIJTL-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|