C15H23N7O11S2 — CID 146585762
tert-butyl N-[methyl-[C-[(1R,7S)-5-methyl-9-oxo-10-sulfooxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-N-sulfooxycarbonimidoyl]amino]carbamate (PubChem CID 146585762) has the molecular formula C15H23N7O11S2 and a molecular weight of 541.52 g/mol. Its IUPAC name is tert-butyl N-[methyl-[C-[(1R,7S)-5-methyl-9-oxo-10-sulfooxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-N-sulfooxycarbonimidoyl]amino]carbamate.
| Compound Name | tert-butyl N-[methyl-[C-[(1R,7S)-5-methyl-9-oxo-10-sulfooxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-N-sulfooxycarbonimidoyl]amino]carbamate |
|---|---|
| PubChem CID | 146585762 |
| Molecular Formula | C15H23N7O11S2 |
| Molecular Weight | 541.52 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | tert-butyl N-[methyl-[C-[(1R,7S)-5-methyl-9-oxo-10-sulfooxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-N-sulfooxycarbonimidoyl]amino]carbamate |
| SMILES | CN(NC(=O)OC(C)(C)C)C(=NOS(=O)(=O)O)[C@@H]1c2c(cnn2C)[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C15H23N7O11S2/c1-15(2,3)31-13(23)17-20(5)12(18-32-34(25,26)27)11-10-8(6-16-19(10)4)9-7-21(11)14(24)22(9)33-35(28,29)30/h6,9,11H,7H2,1-5H3,(H,17,23)(H,25,26,27)(H,28,29,30)/t9-,11-/m0/s1 |
| InChIKey | LAFJMCFLPKIXFO-ONGXEEELSA-N |
| XLogP | -0.51 |
| TPSA | 222.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.52 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|