C12H18N6O7S — CID 78426450
[(1R,7S)-5-methyl-7-[2-(methylamino)ethoxycarbamoyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate (PubChem CID 78426450) has the molecular formula C12H18N6O7S and a molecular weight of 390.38 g/mol. Its IUPAC name is [(1R,7S)-5-methyl-7-[2-(methylamino)ethoxycarbamoyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate.
| Compound Name | [(1R,7S)-5-methyl-7-[2-(methylamino)ethoxycarbamoyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 78426450 |
| Molecular Formula | C12H18N6O7S |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | [(1R,7S)-5-methyl-7-[2-(methylamino)ethoxycarbamoyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
| SMILES | CNCCONC(=O)[C@@H]1c2c(cnn2C)[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C12H18N6O7S/c1-13-3-4-24-15-11(19)10-9-7(5-14-16(9)2)8-6-17(10)12(20)18(8)25-26(21,22)23/h5,8,10,13H,3-4,6H2,1-2H3,(H,15,19)(H,21,22,23)/t8-,10-/m0/s1 |
| InChIKey | BMATWCMYQLLSHN-WPRPVWTQSA-N |
| XLogP | -1.74 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|