C17H22N8O9S — CID 146585770
[(1R,7S)-7-[(E)-C-[[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]methyl]-N-hydroxycarbonimidoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate (PubChem CID 146585770) has the molecular formula C17H22N8O9S and a molecular weight of 514.48 g/mol. Its IUPAC name is [(1R,7S)-7-[(E)-C-[[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]methyl]-N-hydroxycarbonimidoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate.
| Compound Name | [(1R,7S)-7-[(E)-C-[[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]methyl]-N-hydroxycarbonimidoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 146585770 |
| Molecular Formula | C17H22N8O9S |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | [(1R,7S)-7-[(E)-C-[[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]methyl]-N-hydroxycarbonimidoyl]-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
| SMILES | CCN1CCN(C(=O)NC/C(=N\O)[C@@H]2c3c(cnn3C)[C@@H]3CN2C(=O)N3OS(=O)(=O)O)C(=O)C1=O |
| InChI | InChI=1S/C17H22N8O9S/c1-3-22-4-5-23(15(27)14(22)26)16(28)18-7-10(20-30)13-12-9(6-19-21(12)2)11-8-24(13)17(29)25(11)34-35(31,32)33/h6,11,13,30H,3-5,7-8H2,1-2H3,(H,18,28)(H,31,32,33)/b20-10+/t11-,13+/m0/s1 |
| InChIKey | YDVMGMSFOQBHEV-IIIPAAPISA-N |
| XLogP | -1.78 |
| TPSA | 207.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|