C10H13N6NaO6S — CID 153408303
sodium [(1R,7S)-7-(N-hydroxy-N'-methylcarbamimidoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] sulfate (PubChem CID 153408303) has the molecular formula C10H13N6NaO6S and a molecular weight of 368.31 g/mol. Its IUPAC name is sodium [(1R,7S)-7-(N-hydroxy-N'-methylcarbamimidoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] sulfate.
| Compound Name | sodium [(1R,7S)-7-(N-hydroxy-N'-methylcarbamimidoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] sulfate |
|---|---|
| PubChem CID | 153408303 |
| Molecular Formula | C10H13N6NaO6S |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | sodium [(1R,7S)-7-(N-hydroxy-N'-methylcarbamimidoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] sulfate |
| SMILES | C/N=C(\NO)[C@@H]1c2c(cnn2C)[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H14N6O6S.Na/c1-11-9(13-18)8-7-5(3-12-14(7)2)6-4-15(8)10(17)16(6)22-23(19,20)21;/h3,6,8,18H,4H2,1-2H3,(H,11,13)(H,19,20,21);/q;+1/p-1/t6-,8-;/m0./s1 |
| InChIKey | DENRJGZATCJYJD-QMGYSKNISA-M |
| XLogP | -4.34 |
| TPSA | 152.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|