C13H18N4O8S — CID 144703291
[(7S)-7-[3-(methylamino)propoxycarbamoyl]-9-oxo-5-oxa-8,10-diazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate (PubChem CID 144703291) has the molecular formula C13H18N4O8S and a molecular weight of 390.37 g/mol. Its IUPAC name is [(7S)-7-[3-(methylamino)propoxycarbamoyl]-9-oxo-5-oxa-8,10-diazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate.
| Compound Name | [(7S)-7-[3-(methylamino)propoxycarbamoyl]-9-oxo-5-oxa-8,10-diazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 144703291 |
| Molecular Formula | C13H18N4O8S |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | [(7S)-7-[3-(methylamino)propoxycarbamoyl]-9-oxo-5-oxa-8,10-diazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
| SMILES | CNCCCONC(=O)[C@@H]1c2occc2C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H18N4O8S/c1-14-4-2-5-24-15-12(18)10-11-8(3-6-23-11)9-7-16(10)13(19)17(9)25-26(20,21)22/h3,6,9-10,14H,2,4-5,7H2,1H3,(H,15,18)(H,20,21,22)/t9?,10-/m0/s1 |
| InChIKey | RLSWWWGPRCPAED-AXDSSHIGSA-N |
| XLogP | -0.50 |
| TPSA | 150.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|