C13H16N4O7S2 — CID 123916415
[7-[(2-methylpropanoylamino)carbamoyl]-9-oxo-5-thia-8,10-diazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate (PubChem CID 123916415) has the molecular formula C13H16N4O7S2 and a molecular weight of 404.43 g/mol. Its IUPAC name is [7-[(2-methylpropanoylamino)carbamoyl]-9-oxo-5-thia-8,10-diazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate.
| Compound Name | [7-[(2-methylpropanoylamino)carbamoyl]-9-oxo-5-thia-8,10-diazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 123916415 |
| Molecular Formula | C13H16N4O7S2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | [7-[(2-methylpropanoylamino)carbamoyl]-9-oxo-5-thia-8,10-diazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
| SMILES | CC(C)C(=O)NNC(=O)C1c2sccc2C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H16N4O7S2/c1-6(2)11(18)14-15-12(19)9-10-7(3-4-25-10)8-5-16(9)13(20)17(8)24-26(21,22)23/h3-4,6,8-9H,5H2,1-2H3,(H,14,18)(H,15,19)(H,21,22,23) |
| InChIKey | UPISPBKGMOFMMB-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|