C15H16N4O7S — CID 90423088
[(1R,8S)-8-[(cyclopropanecarbonylamino)carbamoyl]-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] hydrogen sulfate (PubChem CID 90423088) has the molecular formula C15H16N4O7S and a molecular weight of 396.38 g/mol. Its IUPAC name is [(1R,8S)-8-[(cyclopropanecarbonylamino)carbamoyl]-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] hydrogen sulfate.
| Compound Name | [(1R,8S)-8-[(cyclopropanecarbonylamino)carbamoyl]-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90423088 |
| Molecular Formula | C15H16N4O7S |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | [(1R,8S)-8-[(cyclopropanecarbonylamino)carbamoyl]-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] hydrogen sulfate |
| SMILES | O=C(NNC(=O)[C@@H]1c2ccccc2[C@@H]2CN1C(=O)N2OS(=O)(=O)O)C1CC1 |
| InChI | InChI=1S/C15H16N4O7S/c20-13(8-5-6-8)16-17-14(21)12-10-4-2-1-3-9(10)11-7-18(12)15(22)19(11)26-27(23,24)25/h1-4,8,11-12H,5-7H2,(H,16,20)(H,17,21)(H,23,24,25)/t11-,12-/m0/s1 |
| InChIKey | MYLVYUJCHVYRGX-RYUDHWBXSA-N |
| XLogP | -0.19 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|