C12H12N3NaO7S — CID 172850555
sodium [(1R,8R)-8-(carbamoyloxymethyl)-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] sulfate (PubChem CID 172850555) has the molecular formula C12H12N3NaO7S and a molecular weight of 365.30 g/mol. Its IUPAC name is sodium [(1R,8R)-8-(carbamoyloxymethyl)-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] sulfate.
| Compound Name | sodium [(1R,8R)-8-(carbamoyloxymethyl)-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] sulfate |
|---|---|
| PubChem CID | 172850555 |
| Molecular Formula | C12H12N3NaO7S |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | sodium [(1R,8R)-8-(carbamoyloxymethyl)-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] sulfate |
| SMILES | NC(=O)OC[C@H]1c2ccccc2[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C12H13N3O7S.Na/c13-11(16)21-6-10-8-4-2-1-3-7(8)9-5-14(10)12(17)15(9)22-23(18,19)20;/h1-4,9-10H,5-6H2,(H2,13,16)(H,18,19,20);/q;+1/p-1/t9-,10-;/m0./s1 |
| InChIKey | XZWQUWZTPYPWEF-IYPAPVHQSA-M |
| XLogP | -2.99 |
| TPSA | 142.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|