C10H14N6O6S — CID 140548225
[(1S,7R)-7-(aminomethyl)-4-(2-amino-2-oxoethyl)-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate (PubChem CID 140548225) has the molecular formula C10H14N6O6S and a molecular weight of 346.33 g/mol. Its IUPAC name is [(1S,7R)-7-(aminomethyl)-4-(2-amino-2-oxoethyl)-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate.
| Compound Name | [(1S,7R)-7-(aminomethyl)-4-(2-amino-2-oxoethyl)-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 140548225 |
| Molecular Formula | C10H14N6O6S |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | [(1S,7R)-7-(aminomethyl)-4-(2-amino-2-oxoethyl)-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate |
| SMILES | NC[C@@H]1c2nn(CC(N)=O)cc2[C@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C10H14N6O6S/c11-1-6-9-5(2-14(13-9)4-8(12)17)7-3-15(6)10(18)16(7)22-23(19,20)21/h2,6-7H,1,3-4,11H2,(H2,12,17)(H,19,20,21)/t6-,7-/m1/s1 |
| InChIKey | AGRYHKMIUNIUSE-RNFRBKRXSA-N |
| XLogP | -2.11 |
| TPSA | 174.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|