C9H12N6O5S — CID 142708258
[(1S,7R)-7-(aminomethyl)-4-methanimidoyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate (PubChem CID 142708258) has the molecular formula C9H12N6O5S and a molecular weight of 316.30 g/mol. Its IUPAC name is [(1S,7R)-7-(aminomethyl)-4-methanimidoyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate.
| Compound Name | [(1S,7R)-7-(aminomethyl)-4-methanimidoyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 142708258 |
| Molecular Formula | C9H12N6O5S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | [(1S,7R)-7-(aminomethyl)-4-methanimidoyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate |
| SMILES | [H]/N=C/n1cc2c(n1)[C@@H](CN)N1C[C@H]2N(OS(=O)(=O)O)C1=O |
| InChI | InChI=1S/C9H12N6O5S/c10-1-6-8-5(2-13(4-11)12-8)7-3-14(6)9(16)15(7)20-21(17,18)19/h2,4,6-7,11H,1,3,10H2,(H,17,18,19)/b11-4+/t6-,7-/m1/s1 |
| InChIKey | UYDHXHNRSNVXCM-VTDPPBADSA-N |
| XLogP | -1.14 |
| TPSA | 154.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|