C11H17N7O6S — CID 91227128
[(1S)-4-(2-aminoethylcarbamoyl)-7-(aminomethyl)-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate (PubChem CID 91227128) has the molecular formula C11H17N7O6S and a molecular weight of 375.37 g/mol. Its IUPAC name is [(1S)-4-(2-aminoethylcarbamoyl)-7-(aminomethyl)-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate.
| Compound Name | [(1S)-4-(2-aminoethylcarbamoyl)-7-(aminomethyl)-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 91227128 |
| Molecular Formula | C11H17N7O6S |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | [(1S)-4-(2-aminoethylcarbamoyl)-7-(aminomethyl)-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate |
| SMILES | NCCNC(=O)n1cc2c(n1)C(CN)N1C[C@H]2N(OS(=O)(=O)O)C1=O |
| InChI | InChI=1S/C11H17N7O6S/c12-1-2-14-10(19)17-4-6-8-5-16(7(3-13)9(6)15-17)11(20)18(8)24-25(21,22)23/h4,7-8H,1-3,5,12-13H2,(H,14,19)(H,21,22,23)/t7?,8-/m1/s1 |
| InChIKey | OOTUWKHDXBMIPD-BRFYHDHCSA-N |
| XLogP | -2.07 |
| TPSA | 186.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|