C10H14N8O6S — CID 67266029
[4-carbamoyl-7-[(diaminomethylideneamino)methyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate (PubChem CID 67266029) has the molecular formula C10H14N8O6S and a molecular weight of 374.34 g/mol. Its IUPAC name is [4-carbamoyl-7-[(diaminomethylideneamino)methyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate.
| Compound Name | [4-carbamoyl-7-[(diaminomethylideneamino)methyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 67266029 |
| Molecular Formula | C10H14N8O6S |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | [4-carbamoyl-7-[(diaminomethylideneamino)methyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate |
| SMILES | NC(=O)n1cc2c(n1)C(CN=C(N)N)N1CC2N(OS(=O)(=O)O)C1=O |
| InChI | InChI=1S/C10H14N8O6S/c11-8(12)14-1-5-7-4(2-17(15-7)9(13)19)6-3-16(5)10(20)18(6)24-25(21,22)23/h2,5-6H,1,3H2,(H2,13,19)(H4,11,12,14)(H,21,22,23) |
| InChIKey | BUPFTHWKGSKMMG-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 212.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|