C13H18N6O6S2 — CID 162464758
[(1R,7S)-5-[(diaminomethylideneamino)methyl]-7-(dimethylcarbamoyl)-9-oxo-3-thia-8,10-diazatricyclo[6.2.1.02,6]undeca-2(6),4-dien-10-yl] hydrogen sulfate (PubChem CID 162464758) has the molecular formula C13H18N6O6S2 and a molecular weight of 418.46 g/mol. Its IUPAC name is [(1R,7S)-5-[(diaminomethylideneamino)methyl]-7-(dimethylcarbamoyl)-9-oxo-3-thia-8,10-diazatricyclo[6.2.1.02,6]undeca-2(6),4-dien-10-yl] hydrogen sulfate.
| Compound Name | [(1R,7S)-5-[(diaminomethylideneamino)methyl]-7-(dimethylcarbamoyl)-9-oxo-3-thia-8,10-diazatricyclo[6.2.1.02,6]undeca-2(6),4-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 162464758 |
| Molecular Formula | C13H18N6O6S2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | [(1R,7S)-5-[(diaminomethylideneamino)methyl]-7-(dimethylcarbamoyl)-9-oxo-3-thia-8,10-diazatricyclo[6.2.1.02,6]undeca-2(6),4-dien-10-yl] hydrogen sulfate |
| SMILES | CN(C)C(=O)[C@@H]1c2c(CN=C(N)N)csc2[C@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H18N6O6S2/c1-17(2)11(20)9-8-6(3-16-12(14)15)5-26-10(8)7-4-18(9)13(21)19(7)25-27(22,23)24/h5,7,9H,3-4H2,1-2H3,(H4,14,15,16)(H,22,23,24)/t7-,9+/m1/s1 |
| InChIKey | MVIMHPSSHOAGME-APPZFPTMSA-N |
| XLogP | -0.82 |
| TPSA | 171.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|