C16H24N8O7S — CID 135213661
[3-[(1-carbamimidoylazetidin-3-yl)oxymethyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate (PubChem CID 135213661) has the molecular formula C16H24N8O7S and a molecular weight of 472.48 g/mol. Its IUPAC name is [3-[(1-carbamimidoylazetidin-3-yl)oxymethyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate.
| Compound Name | [3-[(1-carbamimidoylazetidin-3-yl)oxymethyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 135213661 |
| Molecular Formula | C16H24N8O7S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | [3-[(1-carbamimidoylazetidin-3-yl)oxymethyl]-7-(dimethylcarbamoyl)-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
| SMILES | [H]/N=C(\N)N1CC(OCc2nn(C)c3c2C2CN(C(=O)N2OS(=O)(=O)O)C3C(=O)N(C)C)C1 |
| InChI | InChI=1S/C16H24N8O7S/c1-20(2)14(25)13-12-11(10-6-23(13)16(26)24(10)31-32(27,28)29)9(19-21(12)3)7-30-8-4-22(5-8)15(17)18/h8,10,13H,4-7H2,1-3H3,(H3,17,18)(H,27,28,29) |
| InChIKey | BXGLYUVZJWUMNP-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 187.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|