C8H12N6O5S — CID 90073880
[(2R,5S)-2-(2-methyltetrazol-5-yl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 90073880) has the molecular formula C8H12N6O5S and a molecular weight of 304.29 g/mol. Its IUPAC name is [(2R,5S)-2-(2-methyltetrazol-5-yl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2R,5S)-2-(2-methyltetrazol-5-yl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90073880 |
| Molecular Formula | C8H12N6O5S |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | [(2R,5S)-2-(2-methyltetrazol-5-yl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | Cn1nnc([C@H]2CC[C@H]3CN2C(=O)N3OS(=O)(=O)O)n1 |
| InChI | InChI=1S/C8H12N6O5S/c1-12-10-7(9-11-12)6-3-2-5-4-13(6)8(15)14(5)19-20(16,17)18/h5-6H,2-4H2,1H3,(H,16,17,18)/t5-,6+/m0/s1 |
| InChIKey | ZFHDWRVNXVQODI-NTSWFWBYSA-N |
| XLogP | -1.11 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|