C10H15N7O6S — CID 71761200
[(2S,5R)-2-[5-[(diaminomethylideneamino)methyl]-1,3,4-oxadiazol-2-yl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 71761200) has the molecular formula C10H15N7O6S and a molecular weight of 361.34 g/mol. Its IUPAC name is [(2S,5R)-2-[5-[(diaminomethylideneamino)methyl]-1,3,4-oxadiazol-2-yl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[5-[(diaminomethylideneamino)methyl]-1,3,4-oxadiazol-2-yl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 71761200 |
| Molecular Formula | C10H15N7O6S |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | [(2S,5R)-2-[5-[(diaminomethylideneamino)methyl]-1,3,4-oxadiazol-2-yl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC(N)=NCc1nnc([C@@H]2CC[C@@H]3CN2C(=O)N3OS(=O)(=O)O)o1 |
| InChI | InChI=1S/C10H15N7O6S/c11-9(12)13-3-7-14-15-8(22-7)6-2-1-5-4-16(6)10(18)17(5)23-24(19,20)21/h5-6H,1-4H2,(H4,11,12,13)(H,19,20,21)/t5-,6+/m1/s1 |
| InChIKey | DZNJKZCCSNJKTI-RITPCOANSA-N |
| XLogP | -1.48 |
| TPSA | 190.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|