C11H17N7O5S2 — CID 71761046
[(2S,5R)-2-[5-[2-(diaminomethylideneamino)ethyl]-1,3,4-thiadiazol-2-yl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 71761046) has the molecular formula C11H17N7O5S2 and a molecular weight of 391.44 g/mol. Its IUPAC name is [(2S,5R)-2-[5-[2-(diaminomethylideneamino)ethyl]-1,3,4-thiadiazol-2-yl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[5-[2-(diaminomethylideneamino)ethyl]-1,3,4-thiadiazol-2-yl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 71761046 |
| Molecular Formula | C11H17N7O5S2 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | [(2S,5R)-2-[5-[2-(diaminomethylideneamino)ethyl]-1,3,4-thiadiazol-2-yl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC(N)=NCCc1nnc([C@@H]2CC[C@@H]3CN2C(=O)N3OS(=O)(=O)O)s1 |
| InChI | InChI=1S/C11H17N7O5S2/c12-10(13)14-4-3-8-15-16-9(24-8)7-2-1-6-5-17(7)11(19)18(6)23-25(20,21)22/h6-7H,1-5H2,(H4,12,13,14)(H,20,21,22)/t6-,7+/m1/s1 |
| InChIKey | TZKYLANNEZIZAX-RQJHMYQMSA-N |
| XLogP | -0.97 |
| TPSA | 177.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|