C8H14N4O7S2 — CID 167432338
[(2S,5R)-2-[(Z)-N'-methylsulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 167432338) has the molecular formula C8H14N4O7S2 and a molecular weight of 342.36 g/mol. Its IUPAC name is [(2S,5R)-2-[(Z)-N'-methylsulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[(Z)-N'-methylsulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 167432338 |
| Molecular Formula | C8H14N4O7S2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | [(2S,5R)-2-[(Z)-N'-methylsulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CS(=O)(=O)/N=C(\N)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C8H14N4O7S2/c1-20(14,15)10-7(9)6-3-2-5-4-11(6)8(13)12(5)19-21(16,17)18/h5-6H,2-4H2,1H3,(H2,9,10)(H,16,17,18)/t5-,6+/m1/s1 |
| InChIKey | OXSGUYQSHPOVQD-RITPCOANSA-N |
| XLogP | -1.69 |
| TPSA | 159.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|