C8H12F2N4O7S2 — CID 174229701
[2-[N'-(difluoromethylsulfonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 174229701) has the molecular formula C8H12F2N4O7S2 and a molecular weight of 378.34 g/mol. Its IUPAC name is [2-[N'-(difluoromethylsulfonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[N'-(difluoromethylsulfonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 174229701 |
| Molecular Formula | C8H12F2N4O7S2 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | [2-[N'-(difluoromethylsulfonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC(=NS(=O)(=O)C(F)F)C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C8H12F2N4O7S2/c9-7(10)22(16,17)12-6(11)5-2-1-4-3-13(5)8(15)14(4)21-23(18,19)20/h4-5,7H,1-3H2,(H2,11,12)(H,18,19,20) |
| InChIKey | NGDCAIIGDXMVDU-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 159.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|