C10H17N5O7S2 — CID 172792903
[(2S,5R)-2-[N'-(azetidin-1-ylsulfonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 172792903) has the molecular formula C10H17N5O7S2 and a molecular weight of 383.41 g/mol. Its IUPAC name is [(2S,5R)-2-[N'-(azetidin-1-ylsulfonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[N'-(azetidin-1-ylsulfonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 172792903 |
| Molecular Formula | C10H17N5O7S2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | [(2S,5R)-2-[N'-(azetidin-1-ylsulfonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC(=NS(=O)(=O)N1CCC1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C10H17N5O7S2/c11-9(12-23(17,18)13-4-1-5-13)8-3-2-7-6-14(8)10(16)15(7)22-24(19,20)21/h7-8H,1-6H2,(H2,11,12)(H,19,20,21)/t7-,8+/m1/s1 |
| InChIKey | PUVNHXRNEKGEQW-SFYZADRCSA-N |
| XLogP | -1.70 |
| TPSA | 162.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|