C13H23N5O7S2 — CID 172810136
[(2S,5R)-2-[N'-(4-aminocyclohexyl)sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 172810136) has the molecular formula C13H23N5O7S2 and a molecular weight of 425.49 g/mol. Its IUPAC name is [(2S,5R)-2-[N'-(4-aminocyclohexyl)sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[N'-(4-aminocyclohexyl)sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 172810136 |
| Molecular Formula | C13H23N5O7S2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | [(2S,5R)-2-[N'-(4-aminocyclohexyl)sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC(=NS(=O)(=O)C1CCC(N)CC1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H23N5O7S2/c14-8-1-4-10(5-2-8)26(20,21)16-12(15)11-6-3-9-7-17(11)13(19)18(9)25-27(22,23)24/h8-11H,1-7,14H2,(H2,15,16)(H,22,23,24)/t8?,9-,10?,11+/m1/s1 |
| InChIKey | SBESUWRGSXXTSC-DJRKXVOMSA-N |
| XLogP | -1.05 |
| TPSA | 185.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|